C33H39FN4O6 — CID 130443657
N'-[(2Z,4E)-6-fluoro-1-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyhepta-2,4-dien-4-yl]-N-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 130443657) has the molecular formula C33H39FN4O6 and a molecular weight of 606.70 g/mol. Its IUPAC name is N'-[(2Z,4E)-6-fluoro-1-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyhepta-2,4-dien-4-yl]-N-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(2Z,4E)-6-fluoro-1-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyhepta-2,4-dien-4-yl]-N-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 130443657 |
| Molecular Formula | C33H39FN4O6 |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | N'-[(2Z,4E)-6-fluoro-1-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyhepta-2,4-dien-4-yl]-N-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)NC(/C=C\COc2ccnc3cc(OCC4CCNCC4)c(OC)cc23)=C/C(C)F)cc1 |
| InChI | InChI=1S/C33H39FN4O6/c1-22(34)17-25(38-33(40)32(39)37-20-23-6-8-26(41-2)9-7-23)5-4-16-43-29-12-15-36-28-19-31(30(42-3)18-27(28)29)44-21-24-10-13-35-14-11-24/h4-9,12,15,17-19,22,24,35H,10-11,13-14,16,20-21H2,1-3H3,(H,37,39)(H,38,40)/b5-4-,25-17+ |
| InChIKey | KDFBTBUKGHDVLC-WBEIMRSESA-N |
| XLogP | 4.24 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|