C31H30ClFN4O5 — CID 68808317
N'-[(4-chlorophenyl)methyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 68808317) has the molecular formula C31H30ClFN4O5 and a molecular weight of 593.06 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N'-[(4-chlorophenyl)methyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 68808317 |
| Molecular Formula | C31H30ClFN4O5 |
| Molecular Weight | 593.06 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | N'-[(4-chlorophenyl)methyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(N(Cc4ccc(Cl)cc4)C(=O)C(N)=O)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C31H30ClFN4O5/c1-40-28-15-23-25(16-29(28)41-18-20-8-11-35-12-9-20)36-13-10-26(23)42-27-7-6-22(14-24(27)33)37(31(39)30(34)38)17-19-2-4-21(32)5-3-19/h2-7,10,13-16,20,35H,8-9,11-12,17-18H2,1H3,(H2,34,38) |
| InChIKey | SHRIWHDIQWBKEQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.06 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|