C34H38FN5O5 — CID 68806917
N'-[2-(dimethylamino)-2-phenylethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 68806917) has the molecular formula C34H38FN5O5 and a molecular weight of 615.71 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-2-phenylethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N'-[2-(dimethylamino)-2-phenylethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 68806917 |
| Molecular Formula | C34H38FN5O5 |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | N'-[2-(dimethylamino)-2-phenylethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(N(CC(c4ccccc4)N(C)C)C(=O)C(N)=O)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C34H38FN5O5/c1-39(2)28(23-7-5-4-6-8-23)20-40(34(42)33(36)41)24-9-10-30(26(35)17-24)45-29-13-16-38-27-19-32(31(43-3)18-25(27)29)44-21-22-11-14-37-15-12-22/h4-10,13,16-19,22,28,37H,11-12,14-15,20-21H2,1-3H3,(H2,36,41) |
| InChIKey | PHQQAUMJFTZRAS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|