C32H30F4N4O5 — CID 68806238
N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]oxamide (PubChem CID 68806238) has the molecular formula C32H30F4N4O5 and a molecular weight of 626.61 g/mol. Its IUPAC name is N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]oxamide.
| Compound Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 68806238 |
| Molecular Formula | C32H30F4N4O5 |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(N(Cc4ccccc4C(F)(F)F)C(=O)C(N)=O)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C32H30F4N4O5/c1-43-28-15-22-25(16-29(28)44-18-19-8-11-38-12-9-19)39-13-10-26(22)45-27-7-6-21(14-24(27)33)40(31(42)30(37)41)17-20-4-2-3-5-23(20)32(34,35)36/h2-7,10,13-16,19,38H,8-9,11-12,17-18H2,1H3,(H2,37,41) |
| InChIKey | RFCGTWIISNFCDF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|