C31H29Cl2FN4O5 — CID 154213361
N'-[(3,5-dichlorophenyl)methyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 154213361) has the molecular formula C31H29Cl2FN4O5 and a molecular weight of 627.50 g/mol. Its IUPAC name is N'-[(3,5-dichlorophenyl)methyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N'-[(3,5-dichlorophenyl)methyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 154213361 |
| Molecular Formula | C31H29Cl2FN4O5 |
| Molecular Weight | 627.50 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | N'-[(3,5-dichlorophenyl)methyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(N(Cc4cc(Cl)cc(Cl)c4)C(=O)C(N)=O)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C31H29Cl2FN4O5/c1-41-28-14-23-25(15-29(28)42-17-18-4-7-36-8-5-18)37-9-6-26(23)43-27-3-2-22(13-24(27)34)38(31(40)30(35)39)16-19-10-20(32)12-21(33)11-19/h2-3,6,9-15,18,36H,4-5,7-8,16-17H2,1H3,(H2,35,39) |
| InChIKey | MJCWLQPVRMUNCB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|