C32H31ClF2N4O5 — CID 154254234
N'-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 154254234) has the molecular formula C32H31ClF2N4O5 and a molecular weight of 625.07 g/mol. Its IUPAC name is N'-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N'-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 154254234 |
| Molecular Formula | C32H31ClF2N4O5 |
| Molecular Weight | 625.07 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | N'-[2-(2-chloro-6-fluorophenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(N(CCc4c(F)cccc4Cl)C(=O)C(N)=O)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C32H31ClF2N4O5/c1-42-29-16-22-26(17-30(29)43-18-19-7-11-37-12-8-19)38-13-9-27(22)44-28-6-5-20(15-25(28)35)39(32(41)31(36)40)14-10-21-23(33)3-2-4-24(21)34/h2-6,9,13,15-17,19,37H,7-8,10-12,14,18H2,1H3,(H2,36,40) |
| InChIKey | ZJOVUVCWUCVORP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.07 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|