C30H27ClF2N4O5 — CID 135350269
N'-(4-chloro-3-fluorophenyl)-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 135350269) has the molecular formula C30H27ClF2N4O5 and a molecular weight of 597.02 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 135350269 |
| Molecular Formula | C30H27ClF2N4O5 |
| Molecular Weight | 597.02 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(N(C(=O)C(N)=O)c4ccc(Cl)c(F)c4)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C30H27ClF2N4O5/c1-40-27-14-20-24(15-28(27)41-16-17-6-9-35-10-7-17)36-11-8-25(20)42-26-5-3-19(13-23(26)33)37(30(39)29(34)38)18-2-4-21(31)22(32)12-18/h2-5,8,11-15,17,35H,6-7,9-10,16H2,1H3,(H2,34,38) |
| InChIKey | JYGXEHPZLZODKU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|