C32H33FN4O5 — CID 154065544
N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-(2-phenylethyl)oxamide (PubChem CID 154065544) has the molecular formula C32H33FN4O5 and a molecular weight of 572.64 g/mol. Its IUPAC name is N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-(2-phenylethyl)oxamide.
| Compound Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 154065544 |
| Molecular Formula | C32H33FN4O5 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-(2-phenylethyl)oxamide |
| SMILES | COc1cc2c(Oc3ccc(N(CCc4ccccc4)C(=O)C(N)=O)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C32H33FN4O5/c1-40-29-18-24-26(19-30(29)41-20-22-9-13-35-14-10-22)36-15-11-27(24)42-28-8-7-23(17-25(28)33)37(32(39)31(34)38)16-12-21-5-3-2-4-6-21/h2-8,11,15,17-19,22,35H,9-10,12-14,16,20H2,1H3,(H2,34,38) |
| InChIKey | MRARMJHFYBCMBJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|