C33H35FN4O5 — CID 66677912
N'-[3-fluoro-4-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]-N'-(2-phenylethyl)oxamide (PubChem CID 66677912) has the molecular formula C33H35FN4O5 and a molecular weight of 586.66 g/mol. Its IUPAC name is N'-[3-fluoro-4-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]-N'-(2-phenylethyl)oxamide.
| Compound Name | N'-[3-fluoro-4-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]-N'-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 66677912 |
| Molecular Formula | C33H35FN4O5 |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | N'-[3-fluoro-4-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]-N'-(2-phenylethyl)oxamide |
| SMILES | COc1cc2c(Oc3ccc(N(CCc4ccccc4)C(=O)C(N)=O)cc3F)ccnc2cc1OCC1CCN(C)CC1 |
| InChI | InChI=1S/C33H35FN4O5/c1-37-15-11-23(12-16-37)21-42-31-20-27-25(19-30(31)41-2)28(10-14-36-27)43-29-9-8-24(18-26(29)34)38(33(40)32(35)39)17-13-22-6-4-3-5-7-22/h3-10,14,18-20,23H,11-13,15-17,21H2,1-2H3,(H2,35,39) |
| InChIKey | HSULNYJBVSCLBP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|