C33H34BrFN4O6 — CID 68806347
N'-[2-(2-bromo-6-methoxyphenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 68806347) has the molecular formula C33H34BrFN4O6 and a molecular weight of 681.56 g/mol. Its IUPAC name is N'-[2-(2-bromo-6-methoxyphenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N'-[2-(2-bromo-6-methoxyphenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 68806347 |
| Molecular Formula | C33H34BrFN4O6 |
| Molecular Weight | 681.56 g/mol |
| Exact Mass | 680.16 |
| IUPAC Name | N'-[2-(2-bromo-6-methoxyphenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(N(CCc4c(Br)cccc4OC)C(=O)C(N)=O)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C33H34BrFN4O6/c1-42-27-5-3-4-24(34)22(27)11-15-39(33(41)32(36)40)21-6-7-29(25(35)16-21)45-28-10-14-38-26-18-31(30(43-2)17-23(26)28)44-19-20-8-12-37-13-9-20/h3-7,10,14,16-18,20,37H,8-9,11-13,15,19H2,1-2H3,(H2,36,40) |
| InChIKey | CYLXBEFNXOIJPG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 125.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|