C27H31FN4O5 — CID 67458270
N-ethyl-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-methyloxamide (PubChem CID 67458270) has the molecular formula C27H31FN4O5 and a molecular weight of 510.57 g/mol. Its IUPAC name is N-ethyl-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-methyloxamide.
| Compound Name | N-ethyl-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 67458270 |
| Molecular Formula | C27H31FN4O5 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-ethyl-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-methyloxamide |
| SMILES | CCNC(=O)C(=O)N(C)c1ccc(Oc2ccnc3cc(OCC4CCNCC4)c(OC)cc23)c(F)c1 |
| InChI | InChI=1S/C27H31FN4O5/c1-4-30-26(33)27(34)32(2)18-5-6-23(20(28)13-18)37-22-9-12-31-21-15-25(24(35-3)14-19(21)22)36-16-17-7-10-29-11-8-17/h5-6,9,12-15,17,29H,4,7-8,10-11,16H2,1-3H3,(H,30,33) |
| InChIKey | WYUGKDYHXAOMCF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|