C33H35FN4O7 — CID 154196655
N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxamide (PubChem CID 154196655) has the molecular formula C33H35FN4O7 and a molecular weight of 618.66 g/mol. Its IUPAC name is N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxamide.
| Compound Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 154196655 |
| Molecular Formula | C33H35FN4O7 |
| Molecular Weight | 618.66 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N'-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1cc(CCN(C(=O)C(N)=O)c2ccc(Oc3ccnc4cc(OCC5CCNCC5)c(OC)cc34)c(F)c2)ccc1O |
| InChI | InChI=1S/C33H35FN4O7/c1-42-29-15-20(3-5-26(29)39)10-14-38(33(41)32(35)40)22-4-6-28(24(34)16-22)45-27-9-13-37-25-18-31(30(43-2)17-23(25)27)44-19-21-7-11-36-12-8-21/h3-6,9,13,15-18,21,36,39H,7-8,10-12,14,19H2,1-2H3,(H2,35,40) |
| InChIKey | PYCYCPBXZZINIA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 145.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|