C34H35FN4O5S — CID 87098376
N-[[3-fluoro-4-[6-methoxy-7-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methoxy]quinolin-4-yl]oxyphenyl]-sulfanylcarbamoyl]-2-phenylacetamide (PubChem CID 87098376) has the molecular formula C34H35FN4O5S and a molecular weight of 630.74 g/mol. Its IUPAC name is N-[[3-fluoro-4-[6-methoxy-7-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methoxy]quinolin-4-yl]oxyphenyl]-sulfanylcarbamoyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[6-methoxy-7-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methoxy]quinolin-4-yl]oxyphenyl]-sulfanylcarbamoyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 87098376 |
| Molecular Formula | C34H35FN4O5S |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | N-[[3-fluoro-4-[6-methoxy-7-[(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)methoxy]quinolin-4-yl]oxyphenyl]-sulfanylcarbamoyl]-2-phenylacetamide |
| SMILES | COc1cc2c(Oc3ccc(N(S)C(=O)NC(=O)Cc4ccccc4)cc3F)ccnc2cc1OCC1CC2CN(C)CC2C1 |
| InChI | InChI=1S/C34H35FN4O5S/c1-38-18-23-12-22(13-24(23)19-38)20-43-32-17-28-26(16-31(32)42-2)29(10-11-36-28)44-30-9-8-25(15-27(30)35)39(45)34(41)37-33(40)14-21-6-4-3-5-7-21/h3-11,15-17,22-24,45H,12-14,18-20H2,1-2H3,(H,37,40,41) |
| InChIKey | RKRABTBPTMLMTK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|