C27H24FN3O4S — CID 11443521
N-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-methylcarbamothioyl]-2-phenylacetamide (PubChem CID 11443521) has the molecular formula C27H24FN3O4S and a molecular weight of 505.57 g/mol. Its IUPAC name is N-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-methylcarbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-methylcarbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 11443521 |
| Molecular Formula | C27H24FN3O4S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-methylcarbamothioyl]-2-phenylacetamide |
| SMILES | COc1cc2nccc(Oc3ccc(N(C)C(=S)NC(=O)Cc4ccccc4)cc3F)c2cc1OC |
| InChI | InChI=1S/C27H24FN3O4S/c1-31(27(36)30-26(32)13-17-7-5-4-6-8-17)18-9-10-23(20(28)14-18)35-22-11-12-29-21-16-25(34-3)24(33-2)15-19(21)22/h4-12,14-16H,13H2,1-3H3,(H,30,32,36) |
| InChIKey | IMKFRXAZXQVUGC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|