C29H25FN4O6S — CID 86650714
2-[[4-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carbonyl]amino]propanoic acid (PubChem CID 86650714) has the molecular formula C29H25FN4O6S and a molecular weight of 576.61 g/mol. Its IUPAC name is 2-[[4-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[4-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 86650714 |
| Molecular Formula | C29H25FN4O6S |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 2-[[4-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carbonyl]amino]propanoic acid |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3F)c2cc1C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C29H25FN4O6S/c1-16(28(37)38)32-27(36)20-14-19-22(15-25(20)39-2)31-11-10-23(19)40-24-9-8-18(13-21(24)30)33-29(41)34-26(35)12-17-6-4-3-5-7-17/h3-11,13-16H,12H2,1-2H3,(H,32,36)(H,37,38)(H2,33,34,35,41) |
| InChIKey | AGTGIQQSCWPETC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|