C29H22FN3O3S2 — CID 59424683
N-[[3-fluoro-4-[2-(2-methoxyphenyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 59424683) has the molecular formula C29H22FN3O3S2 and a molecular weight of 543.65 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-(2-methoxyphenyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-(2-methoxyphenyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 59424683 |
| Molecular Formula | C29H22FN3O3S2 |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | N-[[3-fluoro-4-[2-(2-methoxyphenyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | COc1ccccc1-c1cc2nccc(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3F)c2s1 |
| InChI | InChI=1S/C29H22FN3O3S2/c1-35-23-10-6-5-9-20(23)26-17-22-28(38-26)25(13-14-31-22)36-24-12-11-19(16-21(24)30)32-29(37)33-27(34)15-18-7-3-2-4-8-18/h2-14,16-17H,15H2,1H3,(H2,32,33,34,37) |
| InChIKey | MDJKADZYAAAQKY-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|