C32H24FN5O2S2 — CID 24983263
N-[[3-fluoro-4-[2-[4-(pyrazol-1-ylmethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 24983263) has the molecular formula C32H24FN5O2S2 and a molecular weight of 593.71 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-[4-(pyrazol-1-ylmethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-[4-(pyrazol-1-ylmethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 24983263 |
| Molecular Formula | C32H24FN5O2S2 |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | N-[[3-fluoro-4-[2-[4-(pyrazol-1-ylmethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3cc(-c4ccc(Cn5cccn5)cc4)sc23)c(F)c1 |
| InChI | InChI=1S/C32H24FN5O2S2/c33-25-18-24(36-32(41)37-30(39)17-21-5-2-1-3-6-21)11-12-27(25)40-28-13-15-34-26-19-29(42-31(26)28)23-9-7-22(8-10-23)20-38-16-4-14-35-38/h1-16,18-19H,17,20H2,(H2,36,37,39,41) |
| InChIKey | AULHSJWBBMTTCX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|