C33H29FN4O3S2 — CID 87541383
N-[[3-fluoro-4-[2-[4-(pyrrolidin-2-ylmethoxy)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 87541383) has the molecular formula C33H29FN4O3S2 and a molecular weight of 612.75 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-[4-(pyrrolidin-2-ylmethoxy)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-[4-(pyrrolidin-2-ylmethoxy)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 87541383 |
| Molecular Formula | C33H29FN4O3S2 |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | N-[[3-fluoro-4-[2-[4-(pyrrolidin-2-ylmethoxy)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3cc(-c4ccc(OCC5CCCN5)cc4)sc23)c(F)c1 |
| InChI | InChI=1S/C33H29FN4O3S2/c34-26-18-23(37-33(42)38-31(39)17-21-5-2-1-3-6-21)10-13-28(26)41-29-14-16-36-27-19-30(43-32(27)29)22-8-11-25(12-9-22)40-20-24-7-4-15-35-24/h1-3,5-6,8-14,16,18-19,24,35H,4,7,15,17,20H2,(H2,37,38,39,42) |
| InChIKey | DSXZLLQOFJJHHF-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|