C34H31FN4O4S2 — CID 86604178
N-[[3-fluoro-4-[2-[3-(2-morpholin-4-ylethoxy)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 86604178) has the molecular formula C34H31FN4O4S2 and a molecular weight of 642.78 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-[3-(2-morpholin-4-ylethoxy)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-[3-(2-morpholin-4-ylethoxy)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 86604178 |
| Molecular Formula | C34H31FN4O4S2 |
| Molecular Weight | 642.78 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | N-[[3-fluoro-4-[2-[3-(2-morpholin-4-ylethoxy)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3cc(-c4cccc(OCCN5CCOCC5)c4)sc23)c(F)c1 |
| InChI | InChI=1S/C34H31FN4O4S2/c35-27-21-25(37-34(44)38-32(40)19-23-5-2-1-3-6-23)9-10-29(27)43-30-11-12-36-28-22-31(45-33(28)30)24-7-4-8-26(20-24)42-18-15-39-13-16-41-17-14-39/h1-12,20-22H,13-19H2,(H2,37,38,40,44) |
| InChIKey | PPIUIPMUUZXQQE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.78 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|