C24H20FN3O3S2 — CID 87765837
N-[[3-fluoro-4-[2-(2-hydroxyethyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 87765837) has the molecular formula C24H20FN3O3S2 and a molecular weight of 481.57 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-(2-hydroxyethyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-(2-hydroxyethyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 87765837 |
| Molecular Formula | C24H20FN3O3S2 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | N-[[3-fluoro-4-[2-(2-hydroxyethyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3cc(CCO)sc23)c(F)c1 |
| InChI | InChI=1S/C24H20FN3O3S2/c25-18-13-16(27-24(32)28-22(30)12-15-4-2-1-3-5-15)6-7-20(18)31-21-8-10-26-19-14-17(9-11-29)33-23(19)21/h1-8,10,13-14,29H,9,11-12H2,(H2,27,28,30,32) |
| InChIKey | FCJXHSMZKCHEQB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|