C25H21FN4O3S2 — CID 73309223
N-[[3-fluoro-4-[2-(N-methoxy-C-methylcarbonimidoyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 73309223) has the molecular formula C25H21FN4O3S2 and a molecular weight of 508.60 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-(N-methoxy-C-methylcarbonimidoyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-(N-methoxy-C-methylcarbonimidoyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 73309223 |
| Molecular Formula | C25H21FN4O3S2 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | N-[[3-fluoro-4-[2-(N-methoxy-C-methylcarbonimidoyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | CON=C(C)c1cc2nccc(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3F)c2s1 |
| InChI | InChI=1S/C25H21FN4O3S2/c1-15(30-32-2)22-14-19-24(35-22)21(10-11-27-19)33-20-9-8-17(13-18(20)26)28-25(34)29-23(31)12-16-6-4-3-5-7-16/h3-11,13-14H,12H2,1-2H3,(H2,28,29,31,34) |
| InChIKey | UKQWZDPGMJLYLI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|