C26H24FN5O3S2 — CID 87542173
N,N-diethyl-4-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]thieno[3,2-d]pyrimidine-6-carboxamide (PubChem CID 87542173) has the molecular formula C26H24FN5O3S2 and a molecular weight of 537.64 g/mol. Its IUPAC name is N,N-diethyl-4-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]thieno[3,2-d]pyrimidine-6-carboxamide.
| Compound Name | N,N-diethyl-4-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]thieno[3,2-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 87542173 |
| Molecular Formula | C26H24FN5O3S2 |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | N,N-diethyl-4-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]thieno[3,2-d]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2ncnc(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3F)c2s1 |
| InChI | InChI=1S/C26H24FN5O3S2/c1-3-32(4-2)25(34)21-14-19-23(37-21)24(29-15-28-19)35-20-11-10-17(13-18(20)27)30-26(36)31-22(33)12-16-8-6-5-7-9-16/h5-11,13-15H,3-4,12H2,1-2H3,(H2,30,31,33,36) |
| InChIKey | YKGZMBTZBUGUKL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|