C24H20FN5O5S2 — CID 87541841
S-[[3-fluoro-4-[6-[methoxy(methyl)carbamoyl]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]carbamoylamino] 2-phenylethanethioate (PubChem CID 87541841) has the molecular formula C24H20FN5O5S2 and a molecular weight of 541.59 g/mol. Its IUPAC name is S-[[3-fluoro-4-[6-[methoxy(methyl)carbamoyl]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]carbamoylamino] 2-phenylethanethioate.
| Compound Name | S-[[3-fluoro-4-[6-[methoxy(methyl)carbamoyl]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]carbamoylamino] 2-phenylethanethioate |
|---|---|
| PubChem CID | 87541841 |
| Molecular Formula | C24H20FN5O5S2 |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | S-[[3-fluoro-4-[6-[methoxy(methyl)carbamoyl]thieno[3,2-d]pyrimidin-4-yl]oxyphenyl]carbamoylamino] 2-phenylethanethioate |
| SMILES | CON(C)C(=O)c1cc2ncnc(Oc3ccc(NC(=O)NSC(=O)Cc4ccccc4)cc3F)c2s1 |
| InChI | InChI=1S/C24H20FN5O5S2/c1-30(34-2)23(32)19-12-17-21(36-19)22(27-13-26-17)35-18-9-8-15(11-16(18)25)28-24(33)29-37-20(31)10-14-6-4-3-5-7-14/h3-9,11-13H,10H2,1-2H3,(H2,28,29,33) |
| InChIKey | VCBHSGXJUBHNGW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|