C23H20FN5O3S — CID 59424567
N-[[3-fluoro-4-[5-(methoxymethyl)pyrrolo[3,2-d]pyrimidin-4-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 59424567) has the molecular formula C23H20FN5O3S and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[[3-fluoro-4-[5-(methoxymethyl)pyrrolo[3,2-d]pyrimidin-4-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[5-(methoxymethyl)pyrrolo[3,2-d]pyrimidin-4-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 59424567 |
| Molecular Formula | C23H20FN5O3S |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[[3-fluoro-4-[5-(methoxymethyl)pyrrolo[3,2-d]pyrimidin-4-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | COCn1ccc2ncnc(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3F)c21 |
| InChI | InChI=1S/C23H20FN5O3S/c1-31-14-29-10-9-18-21(29)22(26-13-25-18)32-19-8-7-16(12-17(19)24)27-23(33)28-20(30)11-15-5-3-2-4-6-15/h2-10,12-13H,11,14H2,1H3,(H2,27,28,30,33) |
| InChIKey | JGGZVBLUOSWUQT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|