C19H13ClF2N4O2S — CID 11553844
N-[[4-(6-chloropyrimidin-4-yl)oxy-3-fluorophenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide (PubChem CID 11553844) has the molecular formula C19H13ClF2N4O2S and a molecular weight of 434.86 g/mol. Its IUPAC name is N-[[4-(6-chloropyrimidin-4-yl)oxy-3-fluorophenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[4-(6-chloropyrimidin-4-yl)oxy-3-fluorophenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 11553844 |
| Molecular Formula | C19H13ClF2N4O2S |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-[[4-(6-chloropyrimidin-4-yl)oxy-3-fluorophenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)NC(=S)Nc1ccc(Oc2cc(Cl)ncn2)c(F)c1 |
| InChI | InChI=1S/C19H13ClF2N4O2S/c20-16-9-18(24-10-23-16)28-15-6-5-13(8-14(15)22)25-19(29)26-17(27)7-11-1-3-12(21)4-2-11/h1-6,8-10H,7H2,(H2,25,26,27,29) |
| InChIKey | JFKJVQHJHCUMOW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|