C14H11Cl2N3OS — CID 54788250
2-(4-chlorophenyl)-N-[(6-chloro-3-pyridinyl)carbamothioyl]acetamide (PubChem CID 54788250) has the molecular formula C14H11Cl2N3OS and a molecular weight of 340.24 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(6-chloro-3-pyridinyl)carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(6-chloro-3-pyridinyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 54788250 |
| Molecular Formula | C14H11Cl2N3OS |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(6-chloro-3-pyridinyl)carbamothioyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC(=S)Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H11Cl2N3OS/c15-10-3-1-9(2-4-10)7-13(20)19-14(21)18-11-5-6-12(16)17-8-11/h1-6,8H,7H2,(H2,18,19,20,21) |
| InChIKey | LTAHXOZIXXQUHX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|