C18H18ClN3O2S — CID 4936886
N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide (PubChem CID 4936886) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4936886 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2-(4-chlorophenyl)acetamide |
| SMILES | CC(=O)N(C)c1ccc(NC(=S)NC(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H18ClN3O2S/c1-12(23)22(2)16-9-7-15(8-10-16)20-18(25)21-17(24)11-13-3-5-14(19)6-4-13/h3-10H,11H2,1-2H3,(H2,20,21,24,25) |
| InChIKey | XDJBKAGUWUEMOX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|