C17H15Cl2N3O2S — CID 1014380
N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2,4-dichlorobenzamide (PubChem CID 1014380) has the molecular formula C17H15Cl2N3O2S and a molecular weight of 396.30 g/mol. Its IUPAC name is N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2,4-dichlorobenzamide.
| Compound Name | N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 1014380 |
| Molecular Formula | C17H15Cl2N3O2S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2,4-dichlorobenzamide |
| SMILES | CC(=O)N(C)c1ccc(NC(=S)NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2N3O2S/c1-10(23)22(2)13-6-4-12(5-7-13)20-17(25)21-16(24)14-8-3-11(18)9-15(14)19/h3-9H,1-2H3,(H2,20,21,24,25) |
| InChIKey | BIVXXFYWLUUVEH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|