C19H13Cl2N3O2S2 — CID 1342504
N-[4-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]thiophene-2-carboxamide (PubChem CID 1342504) has the molecular formula C19H13Cl2N3O2S2 and a molecular weight of 450.37 g/mol. Its IUPAC name is N-[4-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1342504 |
| Molecular Formula | C19H13Cl2N3O2S2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | N-[4-[(2,4-dichlorobenzoyl)carbamothioylamino]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)NC(=O)c2ccc(Cl)cc2Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C19H13Cl2N3O2S2/c20-11-3-8-14(15(21)10-11)17(25)24-19(27)23-13-6-4-12(5-7-13)22-18(26)16-2-1-9-28-16/h1-10H,(H,22,26)(H2,23,24,25,27) |
| InChIKey | WRANMRVWSWPYTM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|