C22H21N3O5S2 — CID 3143413
N-[4-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]phenyl]thiophene-2-carboxamide (PubChem CID 3143413) has the molecular formula C22H21N3O5S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[4-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3143413 |
| Molecular Formula | C22H21N3O5S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | N-[4-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]phenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(NC(=O)c3cccs3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N3O5S2/c1-28-16-11-13(12-17(29-2)19(16)30-3)20(26)25-22(31)24-15-8-6-14(7-9-15)23-21(27)18-5-4-10-32-18/h4-12H,1-3H3,(H,23,27)(H2,24,25,26,31) |
| InChIKey | UHTQVVPLFWUTKV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|