C16H17N3O2S2 — CID 823741
N-[4-(butanoylcarbamothioylamino)phenyl]thiophene-2-carboxamide (PubChem CID 823741) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is N-[4-(butanoylcarbamothioylamino)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(butanoylcarbamothioylamino)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 823741 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-[4-(butanoylcarbamothioylamino)phenyl]thiophene-2-carboxamide |
| SMILES | CCCC(=O)NC(=S)Nc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H17N3O2S2/c1-2-4-14(20)19-16(22)18-12-8-6-11(7-9-12)17-15(21)13-5-3-10-23-13/h3,5-10H,2,4H2,1H3,(H,17,21)(H2,18,19,20,22) |
| InChIKey | LCYUQYXFWWZKIS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|