C19H20N2O5S — CID 2279251
N-[(3-acetylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 2279251) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[(3-acetylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(3-acetylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2279251 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[(3-acetylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cccc(C(C)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O5S/c1-11(22)12-6-5-7-14(8-12)20-19(27)21-18(23)13-9-15(24-2)17(26-4)16(10-13)25-3/h5-10H,1-4H3,(H2,20,21,23,27) |
| InChIKey | ROXFUFJMEHPXJK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|