C25H20N2O6S — CID 3737326
N-[(9,10-dioxoanthracen-2-yl)carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 3737326) has the molecular formula C25H20N2O6S and a molecular weight of 476.51 g/mol. Its IUPAC name is N-[(9,10-dioxoanthracen-2-yl)carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(9,10-dioxoanthracen-2-yl)carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3737326 |
| Molecular Formula | C25H20N2O6S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | N-[(9,10-dioxoanthracen-2-yl)carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H20N2O6S/c1-31-19-10-13(11-20(32-2)23(19)33-3)24(30)27-25(34)26-14-8-9-17-18(12-14)22(29)16-7-5-4-6-15(16)21(17)28/h4-12H,1-3H3,(H2,26,27,30,34) |
| InChIKey | OQMHTJDOKLQFIZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|