C23H17NO5 — CID 7533072
N-(9,10-dioxoanthracen-2-yl)-2,3-dimethoxybenzamide (PubChem CID 7533072) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2,3-dimethoxybenzamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 7533072 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)c1OC |
| InChI | InChI=1S/C23H17NO5/c1-28-19-9-5-8-17(22(19)29-2)23(27)24-13-10-11-16-18(12-13)21(26)15-7-4-3-6-14(15)20(16)25/h3-12H,1-2H3,(H,24,27) |
| InChIKey | XQXGYTYPHPOECC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|