C24H20N2O5 — CID 22776594
N-[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]-2-methoxy-3-methylbenzamide (PubChem CID 22776594) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is N-[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]-2-methoxy-3-methylbenzamide.
| Compound Name | N-[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 22776594 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]-2-methoxy-3-methylbenzamide |
| SMILES | COc1cc(NC(=O)c2cccc(C)c2OC)ccc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H20N2O5/c1-14-7-6-10-18(21(14)31-3)22(27)25-15-11-12-19(20(13-15)30-2)26-23(28)16-8-4-5-9-17(16)24(26)29/h4-13H,1-3H3,(H,25,27) |
| InChIKey | VRMFBRZURSZTMK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|