C27H19N3O4S — CID 23098051
N-[[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]carbamothioyl]naphthalene-2-carboxamide (PubChem CID 23098051) has the molecular formula C27H19N3O4S and a molecular weight of 481.53 g/mol. Its IUPAC name is N-[[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]carbamothioyl]naphthalene-2-carboxamide.
| Compound Name | N-[[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]carbamothioyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 23098051 |
| Molecular Formula | C27H19N3O4S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]carbamothioyl]naphthalene-2-carboxamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2ccc3ccccc3c2)ccc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H19N3O4S/c1-34-23-15-19(12-13-22(23)30-25(32)20-8-4-5-9-21(20)26(30)33)28-27(35)29-24(31)18-11-10-16-6-2-3-7-17(16)14-18/h2-15H,1H3,(H2,28,29,31,35) |
| InChIKey | WSPYLDPRZXFLCT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|