C22H14Cl2N2O4 — CID 22781355
3,4-dichloro-N-[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]benzamide (PubChem CID 22781355) has the molecular formula C22H14Cl2N2O4 and a molecular weight of 441.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 22781355 |
| Molecular Formula | C22H14Cl2N2O4 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 3,4-dichloro-N-[4-(1,3-dioxoisoindol-2-yl)-3-methoxyphenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(Cl)c(Cl)c2)ccc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H14Cl2N2O4/c1-30-19-11-13(25-20(27)12-6-8-16(23)17(24)10-12)7-9-18(19)26-21(28)14-4-2-3-5-15(14)22(26)29/h2-11H,1H3,(H,25,27) |
| InChIKey | DAIQYVMOLKSRAR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|