C23H15N3O5S — CID 3954517
N-[[4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3954517) has the molecular formula C23H15N3O5S and a molecular weight of 445.46 g/mol. Its IUPAC name is N-[[4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3954517 |
| Molecular Formula | C23H15N3O5S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-[[4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H15N3O5S/c27-20(13-5-10-18-19(11-13)31-12-30-18)25-23(32)24-14-6-8-15(9-7-14)26-21(28)16-3-1-2-4-17(16)22(26)29/h1-11H,12H2,(H2,24,25,27,32) |
| InChIKey | YOFFHIGRRDORQD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|