C15H11N3O5S — CID 3912695
N-[(2-nitrophenyl)carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3912695) has the molecular formula C15H11N3O5S and a molecular weight of 345.34 g/mol. Its IUPAC name is N-[(2-nitrophenyl)carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(2-nitrophenyl)carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3912695 |
| Molecular Formula | C15H11N3O5S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-[(2-nitrophenyl)carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1[N+](=O)[O-])c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H11N3O5S/c19-14(9-5-6-12-13(7-9)23-8-22-12)17-15(24)16-10-3-1-2-4-11(10)18(20)21/h1-7H,8H2,(H2,16,17,19,24) |
| InChIKey | SSSAZYFKKYHRAU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|