C15H10FN3O5S — CID 4030759
N-[(4-fluoro-3-nitrophenyl)carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4030759) has the molecular formula C15H10FN3O5S and a molecular weight of 363.33 g/mol. Its IUPAC name is N-[(4-fluoro-3-nitrophenyl)carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(4-fluoro-3-nitrophenyl)carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4030759 |
| Molecular Formula | C15H10FN3O5S |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-[(4-fluoro-3-nitrophenyl)carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(F)c([N+](=O)[O-])c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H10FN3O5S/c16-10-3-2-9(6-11(10)19(21)22)17-15(25)18-14(20)8-1-4-12-13(5-8)24-7-23-12/h1-6H,7H2,(H2,17,18,20,25) |
| InChIKey | MOYOOXIAHPPMNM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|