C22H14FN3O4S — CID 3994268
N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3994268) has the molecular formula C22H14FN3O4S and a molecular weight of 435.44 g/mol. Its IUPAC name is N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3994268 |
| Molecular Formula | C22H14FN3O4S |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3ccccc3F)nc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H14FN3O4S/c23-15-4-2-1-3-14(15)21-25-16-10-13(6-8-17(16)30-21)24-22(31)26-20(27)12-5-7-18-19(9-12)29-11-28-18/h1-10H,11H2,(H2,24,26,27,31) |
| InChIKey | JGCPMZBPXATHOJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|