C21H13FN4O4S — CID 1136344
N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-nitrobenzamide (PubChem CID 1136344) has the molecular formula C21H13FN4O4S and a molecular weight of 436.42 g/mol. Its IUPAC name is N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 1136344 |
| Molecular Formula | C21H13FN4O4S |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-4-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3ccccc3F)nc2c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H13FN4O4S/c22-16-4-2-1-3-15(16)20-24-17-11-13(7-10-18(17)30-20)23-21(31)25-19(27)12-5-8-14(9-6-12)26(28)29/h1-11H,(H2,23,25,27,31) |
| InChIKey | MNMTXPXPOILXEL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|