C22H16N4O4S — CID 1340129
N-[[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-4-nitrobenzamide (PubChem CID 1340129) has the molecular formula C22H16N4O4S and a molecular weight of 432.46 g/mol. Its IUPAC name is N-[[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 1340129 |
| Molecular Formula | C22H16N4O4S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-4-nitrobenzamide |
| SMILES | Cc1c(NC(=S)NC(=O)c2ccc([N+](=O)[O-])cc2)cccc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C22H16N4O4S/c1-13-16(21-23-18-6-2-3-8-19(18)30-21)5-4-7-17(13)24-22(31)25-20(27)14-9-11-15(12-10-14)26(28)29/h2-12H,1H3,(H2,24,25,27,31) |
| InChIKey | XITNBEXYRJVQFD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|