C22H17Cl2N3O3S — CID 21211855
4-chloro-N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide;hydrate (PubChem CID 21211855) has the molecular formula C22H17Cl2N3O3S and a molecular weight of 474.37 g/mol. Its IUPAC name is 4-chloro-N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide;hydrate.
| Compound Name | 4-chloro-N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide;hydrate |
|---|---|
| PubChem CID | 21211855 |
| Molecular Formula | C22H17Cl2N3O3S |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 4-chloro-N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide;hydrate |
| SMILES | Cc1c(NC(=S)NC(=O)c2ccc(Cl)cc2)cccc1-c1nc2cc(Cl)ccc2o1.O |
| InChI | InChI=1S/C22H15Cl2N3O2S.H2O/c1-12-16(21-25-18-11-15(24)9-10-19(18)29-21)3-2-4-17(12)26-22(30)27-20(28)13-5-7-14(23)8-6-13;/h2-11H,1H3,(H2,26,27,28,30);1H2 |
| InChIKey | XVOIVEWICPUPCL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|