C22H16ClN3O3S — CID 1344844
N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 1344844) has the molecular formula C22H16ClN3O3S and a molecular weight of 437.91 g/mol. Its IUPAC name is N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1344844 |
| Molecular Formula | C22H16ClN3O3S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cc1c(NC(=S)NC(=O)C=Cc2ccco2)cccc1-c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C22H16ClN3O3S/c1-13-16(21-24-18-12-14(23)7-9-19(18)29-21)5-2-6-17(13)25-22(30)26-20(27)10-8-15-4-3-11-28-15/h2-12H,1H3,(H2,25,26,27,30) |
| InChIKey | XVNINMNCPHNHKG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|