C28H19Cl2N3O3S — CID 3882509
N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3882509) has the molecular formula C28H19Cl2N3O3S and a molecular weight of 548.45 g/mol. Its IUPAC name is N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3882509 |
| Molecular Formula | C28H19Cl2N3O3S |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 547.05 |
| IUPAC Name | N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2nc3cc(Cl)ccc3o2)cc1NC(=S)NC(=O)C=Cc1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C28H19Cl2N3O3S/c1-16-2-3-18(27-31-23-15-20(30)8-11-25(23)36-27)14-22(16)32-28(37)33-26(34)13-10-21-9-12-24(35-21)17-4-6-19(29)7-5-17/h2-15H,1H3,(H2,32,33,34,37) |
| InChIKey | PXMNJCQVXALNAW-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|