C24H20ClN3O2S — CID 22782453
N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3,5-dimethylbenzamide (PubChem CID 22782453) has the molecular formula C24H20ClN3O2S and a molecular weight of 449.96 g/mol. Its IUPAC name is N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3,5-dimethylbenzamide.
| Compound Name | N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 22782453 |
| Molecular Formula | C24H20ClN3O2S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC(=S)Nc2cc(-c3nc4cc(Cl)ccc4o3)ccc2C)c1 |
| InChI | InChI=1S/C24H20ClN3O2S/c1-13-8-14(2)10-17(9-13)22(29)28-24(31)27-19-11-16(5-4-15(19)3)23-26-20-12-18(25)6-7-21(20)30-23/h4-12H,1-3H3,(H2,27,28,29,31) |
| InChIKey | PRVFMABKJKQAPK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|