C20H14ClN3O3S — CID 1362607
N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 1362607) has the molecular formula C20H14ClN3O3S and a molecular weight of 411.87 g/mol. Its IUPAC name is N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1362607 |
| Molecular Formula | C20H14ClN3O3S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | N-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2nc3cc(Cl)ccc3o2)cc1NC(=S)NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H14ClN3O3S/c1-11-4-5-12(19-22-15-10-13(21)6-7-16(15)27-19)9-14(11)23-20(28)24-18(25)17-3-2-8-26-17/h2-10H,1H3,(H2,23,24,25,28) |
| InChIKey | GKPDZCWCOWOUAT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|