C30H23Cl2N3O3S — CID 17315650
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]prop-2-enamide (PubChem CID 17315650) has the molecular formula C30H23Cl2N3O3S and a molecular weight of 576.51 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17315650 |
| Molecular Formula | C30H23Cl2N3O3S |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]prop-2-enamide |
| SMILES | CCc1ccc2oc(-c3ccc(C)c(NC(=S)NC(=O)/C=C/c4ccc(-c5cc(Cl)cc(Cl)c5)o4)c3)nc2c1 |
| InChI | InChI=1S/C30H23Cl2N3O3S/c1-3-18-5-9-27-25(12-18)33-29(38-27)19-6-4-17(2)24(15-19)34-30(39)35-28(36)11-8-23-7-10-26(37-23)20-13-21(31)16-22(32)14-20/h4-16H,3H2,1-2H3,(H2,34,35,36,39)/b11-8+ |
| InChIKey | YDAQJIZHKMCKSS-DHZHZOJOSA-N |
| XLogP | 8.46 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|