C27H18Cl2N4O3S — CID 17316377
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17316377) has the molecular formula C27H18Cl2N4O3S and a molecular weight of 549.44 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17316377 |
| Molecular Formula | C27H18Cl2N4O3S |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1cc(-c2nc3ncccc3o2)ccc1NC(=S)NC(=O)/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C27H18Cl2N4O3S/c1-15-11-16(26-33-25-23(36-26)3-2-10-30-25)4-7-21(15)31-27(37)32-24(34)9-6-20-5-8-22(35-20)17-12-18(28)14-19(29)13-17/h2-14H,1H3,(H2,31,32,34,37)/b9-6+ |
| InChIKey | INXPCDINTKFVLZ-RMKNXTFCSA-N |
| XLogP | 7.29 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|